Lihat sumber Isokonazol

{{Infobox drug
|IUPAC_name = (''RS'')-1-[2-[(2,6-Diklorobenzil)oksi]-2-(2,4-diklorofenil)etil]-1''H''-imidazola
|image=Isoconazole.svg

<!--Clinical data-->
|tradename    =
|Drugs.com    = {{drugs.com|international|isoconazole}}
|pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
|pregnancy_category =
|legal_AU     = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
|legal_CA     = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
|legal_UK     = <!-- GSL         / P       / POM / CD / Class A, B, C -->
|legal_US     = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
|legal_status =
|routes_of_administration =

<!--Pharmacokinetic data-->
|bioavailability =
|protein_bound =
|metabolism =
|elimination_half-life =
|excretion =

<!--Identifiers-->
|CAS_number       = 27523-40-6
|ATC_prefix       = D01
|ATC_suffix       = AC05
|ATC_supplemental = {{ATC|G01|AF07}}
|PubChem          = 3760
|DrugBank_Ref     = {{drugbankcite|changed|drugbank}}
|DrugBank         = DB08943
|ChEMBL           = 1571863
|ChemSpiderID     = 3629
|UNII_Ref         = {{fdacite|correct|FDA}}
|UNII             = GRI7WFR424
|KEGG             = D04624
|ChEBI_Ref        = {{ebicite|correct|EBI}}
|ChEBI            = 82865

<!--Chemical data-->
|C=18 |H=14 |Cl=4 |N=2 |O=1
|smiles=Clc1ccc(c(Cl)c1)C(OCc2c(Cl)cccc2Cl)Cn3ccnc3
}}

'''Isokonazol''' adalah obat antijamur azola dan dapat menghambat bakteri gram positif.<ref name=Veraldi2013>{{cite journal | vauthors = Veraldi S | title = Isoconazole nitrate: a unique broad-spectrum antimicrobial azole effective in the treatment of dermatomycoses, both as monotherapy and in combination with corticosteroids | journal = Mycoses | volume = 56 | issue = Suppl 1 | pages = 3–15 | date = May 2013 | pmid = 23574019 | doi = 10.1111/myc.12054 | s2cid = 1881151 }}</ref><ref>{{cite book |title=[[The Merck Index]] |chapter=Isoconazole |edition=12th |page=5176 | isbn = 0-911910-12-3 | veditors = Budavari S | date = 1996 | vauthors = Budavari S, O'Neil M, Smith A, Heckelman P, Obenchain J  }}</ref> Untuk infeksi kaki dan vagina, isokonazol memiliki efektivitas yang sama dengan [[klotrimazol]].<ref name=Oyeka1992>{{cite journal | vauthors = Oyeka CA, Gugnani HC | title = Isoconazole nitrate versus clotrimazole in foot and nail infections due to Hendersonula toruloidea, Scytalidium hyalinum and dermatophytes | journal = Mycoses | volume = 35 | issue = 11–12 | pages = 357–361 | year = 1992 | pmid = 1302811 | doi = 10.1111/j.1439-0507.1992.tb00894.x | s2cid = 6764090 }}</ref><ref name=Cohen1984>{{cite journal | vauthors = Cohen L | title = Single dose treatment of vaginal candidosis: comparison of clotrimazole and isoconazole | journal = The British Journal of Venereal Diseases | volume = 60 | issue = 1 | pages = 42–44 | date = February 1984 | pmid = 6365236 | pmc = 1046268 | doi = 10.1136/sti.60.1.42 }}</ref> Isokonazol nitrat dapat digunakan dalam kombinasi dengan [[kortikosteroid]] [[diflukortolon]] untuk meningkatkan [[bioavailabilitas]]nya.<ref name=Veraldi2013/> Obat ini dipatenkan pada tahun 1968 dan disetujui untuk penggunaan medis pada tahun 1979.<ref name=Fischer2006>{{cite book | vauthors = Fischer J, Ganellin CR |author-link2=C. Robin Ganellin |date=2006 |title=Analogue-based Drug Discovery |language=en |publisher=John Wiley & Sons |isbn=9783527607495 |page=502 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA502}}</ref>
== Referensi ==
{{Reflist|2}}
[[Kategori:Penghambat 21-hidroksilase]]
[[Kategori:Penghambat aromatase]]
[[Kategori:Kloroarena]]
[[Kategori:Penghambat CYP17A1]]
[[Kategori:Eter feniletanolamina]]
[[Kategori:Antijamur imidazola]]
[[Kategori:Penghambat CYP51A1]]