Lihat sumber Albendazol

{{Drugbox
| Watchedfields = changed
| verifiedrevid = 477316402
| IUPAC_name = Methyl [5-(propylthio)-1''H''-benzoimidazol-2-yl]carbamate
| image = Albendazole.svg
| image2 = Albendazole-from-xtal-2007-3D-balls.png
| width2 = 250px

<!--Clinical data-->
| tradename = Albenza, Eskazole, lainnya
| Drugs.com = {{drugs.com|monograph|albendazole}}
| MedlinePlus = a610019
| pregnancy_AU = D
| pregnancy_US = C
| legal_AU = S4
| legal_CA = Rx-only
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = Lewat mulut

<!--Pharmacokinetic data-->
| bioavailability = <5%<ref name = MSR/>
| protein_bound = 70%<ref name = MSR/>
| metabolism = [[Hepatik]]<ref name = MSR/>
| elimination_half-life = 8-12 jam<ref name = MSR>{{cite web|title=Albenza, (albendazole) dosing, indications, interactions, adverse effects, and more|work=Medscape Reference|publisher=WebMD|accessdate=25 February 2014|url=http://reference.medscape.com/drug/albenza-albendazole-342648#showall}}</ref>
| excretion = Urine, faeces<ref name = MSR/>

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 54965-21-8
| ATC_prefix = P02
| ATC_suffix = CA03
| ATC_supplemental =  {{ATCvet|P52|AC11}}
| PubChem = 2082
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00518
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 1998
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F4216019LN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00134
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16664
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1483
| NIAID_ChemDB = 007895

<!--Chemical data-->
| C=12 | H=15 | N=3 | O=2 | S=1
| molecular_weight = 265.333 g/mol
| smiles = O=C(OC)Nc2nc1ccc(SCCC)cc1n2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HXHWSAZORRCQMX-UHFFFAOYSA-N
| melting_point = 208
| melting_high = 210
}}
'''Albendazole''', dipasarkan dengan nama '''Albenza''', adalah obat yang digunakan untuk menangani berbagai macam penyakit [[cacingan]], seperti [[giardiasis]], [[trichuriasis]], [[filariasis]], [[neurosistiserkosis]], [[echinococcosis]], [[enterobiasis]] dan [[askariasis]]. Obat ini dikonsumsi lewat mulut.<ref name=AHFS2015>{{cite web|title=Albendazole|url=http://www.drugs.com/monograph/albendazole.html|publisher=The American Society of Health-System Pharmacists|accessdate=Aug 18, 2015}}</ref>

Efek-efek samping obat ini adalah rasa mual, sakit perut dan sakit kepala. Efek samping yang serius meliputi [[supresi sumsum tulang]] yang biasanya membaik setelah obat tidak lagi dikonsumsi. Peradangan hati juga dilaporkan telah terjadi dan mereka yang memiliki masalah hati menghadapi risiko yang lebih tinggi. Obat ini tergolong dalam [[kategori kehamilan]] C di [[Amerika Serikat]] dan kategori D di [[Australia]], atau dalam kata lain dapat membahayakan kehamilan.<ref name=AHFS2015/><ref>{{cite web|title=Prescribing medicines in pregnancy database|url=http://www.tga.gov.au/hp/medicines-pregnancy.htm#.U1Yw8Bc3tqw|work=Australian Government|accessdate=22 April 2014|date=3 March 2014}}</ref>

Albendazole dikembangkan pada tahun 1975.<ref>{{cite book|title=Neonatal Formulary: Drug Use in Pregnancy and the First Year of Life|date=2014|publisher=John Wiley & Sons|isbn=9781118819593|page=64|url=https://books.google.ca/books?id=VOLhBQAAQBAJ&pg=PA64}}</ref> Obat ini terdaftar di dalam [[Daftar Obat Esensial Organisasi Kesehatan Dunia]], obat-obat paling efektif dan aman yang dibutuhkan oleh dunia medis.<ref name=WHO19th>{{cite web|title=WHO Model List of Essential Medicines (19th List)|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|work=World Health Organization|accessdate=8 December 2016|date=April 2015}}</ref> Harga obat ini di dunia berkembang berkisar antara 0,01 hingga 0,06 dollar per dosis.<ref name=GlobPrice>{{cite web|title=Albendazole|url=http://erc.msh.org/dmpguide/resultsdetail.cfm?language=english&code=ALB200T&s_year=2014&year=2014&str=200%20mg&desc=Albendazole&pack=new&frm=TAB-CAP&rte=PO&class_code2=06%2E1%2E1%2E&supplement=&class_name=%2806%2E1%2E1%2E%29Intestinal%20anthelminthics%3Cbr%3E|website=International Drug Price Indicator Guide|accessdate=18 August 2015|archive-date=2017-03-05|archive-url=https://web.archive.org/web/20170305002135/http://erc.msh.org/dmpguide/resultsdetail.cfm?language=english&code=ALB200T&s_year=2014&year=2014&str=200%20mg&desc=Albendazole&pack=new&frm=TAB-CAP&rte=PO&class_code2=06.1.1.&supplement=&class_name=%2806.1.1.%29Intestinal%20anthelminthics%3Cbr%3E|dead-url=yes}}</ref> Namun, di Amerika Serikat, obat ini sangat mahal dan pada tahun 2015 harganya tercatat sebesar 201 dollar per dosis.<ref>{{cite journal|last1=Alpern|first1=JD|last2=Song|first2=J|last3=Stauffer|first3=WM|title=Essential Medicines in the United States--Why Access Is Diminishing.|journal=The New England journal of medicine|date=19 May 2016|volume=374|issue=20|pages=1904–7|pmid=27192669}}</ref>

== Catatan kaki ==
{{reflist}}

== Pranala luar ==
* [http://www.cartercenter.org/health/lf/index.html The Carter Center Lymphatic Filariasis Elimination Program]
* [http://www.medicinenet.com/albendazole-oral/article.htm MedicineNet article]
* [http://www.rxlist.com/albenza-drug.htm Albenza description at RxList]

[[Kategori:Antelmintik]]
[[Kategori:Benzimidazola]]
[[Kategori:Obat Esensial Nasional Indonesia]]
[[Kategori:Karbamat]]
[[Kategori:Obat yang dikembangkan oleh GSK plc]]
[[Kategori:Tioeter]]
[[Kategori:Senyawa propil]]

{{kedokteran-stub}}
{{Farmasi-stub}}