Lihat sumber Amonium heksakloroplatinat

{{chembox
| Watchedfields = changed
| verifiedrevid = 443387206
| Name = Amonium heksakloroplatinat
| ImageFile = NH4 2PtCl6improved.svg
| ImageSize = 200px 
| ImageName = Amonium heksakloroplatinat
| ImageFile2 = (NH4)2PtCl6Xray.tif
| ImageSize2 = 320px 
| ImageName2 = Amonium heksakloroplatinat
| IUPACName = Amonium heksakloroplatinat(IV)
| OtherNames = amonium kloroplatinat
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10628022
| PubChem = 16211460
| EINECS = 240-973-0
| InChI = 1/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4/rCl6Pt.2H3N/c1-7(2,3,4,5)6;;/h;2*1H3/q-2;;/p+2
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 59604
| SMILES = [NH4+].[NH4+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl
| InChIKey = PCCGQTHFYHJATL-WPAIPAOFAY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/6ClH.2H3N.Pt/h6*1H;2*1H3;/q;;;;;;;;+4/p-4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PCCGQTHFYHJATL-UHFFFAOYSA-J
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 16919-58-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1653N9XMIC
  }}
|Section2={{Chembox Properties
| Formula = (NH<sub>4</sub>)<sub>2</sub>PtCl<sub>6</sub>
| MolarMass = 443,87 g/mol
| Odor = tidak berbau
| Appearance = kristal kuning
| Density = 3,065 g/cm<sup>3</sup>
| MeltingPtC = 380
| MeltingPt_notes = terurai
| Solubility = 0,289 g/100ml (0 °C)<br /> 0,7 g/100ml (15 °C)<ref>{{cite web|url=http://chemister.ru/Database/properties-en.php?dbid=1&id=7145 |title=ammonium hexachloroplatinate(IV) |publisher=Chemister.ru |date=19 Maret 2007 |accessdate=21 Juni 2022}}</ref><br /> 0,499 g/100ml (20 °C)<br /> 3,36 g/100ml (100 °C)}}
| Section7 = {{Chembox Hazards
| Hazards_ref =
| ExternalSDS = 
| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|290|301|317|318|334}}
| PPhrases = {{P-phrases|234|261|264|270|272|280|285|301+310|302+352|304+341|305+351+338|310|321|330|333+313|342+311|363|390|404|405|501}}
| MainHazards = 
| IngestionHazard = 
| InhalationHazard = 
| EyeHazard = 
| SkinHazard = 
| NFPA-F = 
| NFPA-H = 
| NFPA-R = 
| NFPA-S = 
| NFPA_ref = 
| FlashPt =
| FlashPtC =
| FlashPt_notes =
| FlashPt_ref =
| AutoignitionPt =
| AutoignitionPtC =
| AutoignitionPt_ref=
| AutoignitionPt_notes=
| ExploLimits = 
| TLV = 
| TLV-TWA = 
| TLV-STEL = 
| TLV-C = 
| LD50 = 195 mg/kg tikus
| LDLo = 
| LC50 = 
| LCLo = 
| PEL =
| REL = 
| IDLH =
| NIOSH_id =
| NIOSH_ref =
 }}
}}

'''Amonium heksakloroplatinat''', juga dikenal sebagai [[amonium]] kloroplatinat, adalah [[senyawa anorganik]] dengan rumus (NH<sub>4</sub>)<sub>2</sub>[PtCl<sub>6</sub>]. Ia adalah contoh langka dari [[Garam (kimia)|garam]] [[platina]](IV) larut yang tidak [[Higroskopi|higroskopis]]. Ia membentuk larutan yang sangat kuning dalam air. Dengan adanya 1M [[Amonium klorida|NH<sub>4</sub>Cl]], kelarutannya hanya 0,0028&nbsp;g/100&nbsp;mL.

== Preparasi dan struktur ==
Senyawa ini terdiri dari [[Ion|kation]] [[amonium]] [[Struktur molekul tetrahedron|tetrahedral]] yang terpisah dan [[Ion|anion]] [[Geometri molekul oktahedral|oktahedral]] [PtCl<sub>6</sub>]<sup>2&minus;</sup>. Ia biasanya dihasilkan sebagai endapan kuning halus dengan memperlakukan larutan [[Asam kloroplatinat|asam heksakloroplatinat]] dengan larutan garam amonium.<ref name=Kauuf>{{cite book | chapter = Ammonium Hexachloroplatinate(IV) | author = George B. Kauffman | title = Inorganic Syntheses | author-link = George B. Kauffman | year = 1967 | volume = 9 | pages = 182–185 | doi = 10.1002/9780470132401.ch51  | series = Inorganic Syntheses | isbn = 978-0-470-13240-1}}</ref> Kompleks ini sangat sulit larut sehingga langkah ini digunakan dalam isolasi platina dari bijih dan residu daur ulang.<ref>Cotton, S. A. ''Chemistry of Precious Metals'', Chapman and Hall (London): 1997. {{ISBN|0-7514-0413-6}}.</ref>

Seperti yang dianalisis dengan menggunakan [[kristalografi sinar-X]], garam ini mengkristal dalam motif kubik yang mengingatkan pada struktur [[Kalsium fluorida|fluorit]]. Pusat [PtCl<sub>6</sub>]<sup>2−</sup> berbentuk oktahedral. Pusat NH<sub>4</sub><sup>+</sup> adalah [[Ikatan hidrogen|hidrogen yang terikat]] pada [[ligan]] [[klorida]].<ref>Verde-Gómez, Y.; Alonso-Nuñez, G.; Cervantes, F.; Keer, A. "Aqueous solution reaction to synthesize ammonium hexachloroplatinate and its crystallographic and thermogravimetric characterization" Materials Letters, 2003, volume 57, hlm 4667-4672. {{doi|10.1016/S0167-577X(03)00381-1}}</ref>

== Kegunaan dan reaksi ==
Amonium heksakloroplatinat digunakan dalam pelapisan platina. Pemanasan (NH<sub>4</sub>)<sub>2</sub>[PtCl<sub>6</sub>] di bawah aliran [[hidrogen]] pada suhu 200&nbsp;°C akan menghasilkan [[Platina hitam#Spons logam platina|spons platina]]. Jika ia digabungkan dengan dengan [[klorin]], maka akan menghasilkan H<sub>2</sub>[PtCl<sub>6</sub>].<ref name=Kauuf/>

== Lihat pula ==
* [[Asam kloroplatinat]]

== Referensi ==
{{Reflist}}

{{Garam Amonium}}
[[Kategori:Amonium]]
[[Kategori:Klorida]]
[[Kategori:Platina]]
[[Kategori:Senyawa platina(IV)]]
[[Kategori:Kompleks kloro]]
[[Kategori:Senyawa amonium]]
[[Kategori:Heksakloroplatinat]]