Lihat sumber Sefoperazon

{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443509478
| IUPAC_name = (6''R'',7''R'')-7-[(2''R'')-2-{[(4-Etil-2,3-dioksopiperazin-1-il)karbonil]amino}-2-(4-hidroksifenil)asetamido]-3-{[(1-metil-1''H''-1,2,3,4-tetrazol-5-il)sulfanil]metil}-8-oxo-5-tia-1-azabisiklo[4.2.0]okt-2-ena-2-asam karboksilat
| image = Cefoperazone.svg
| image2 = Cefoperazone ball-and-stick.png
<!--Clinical data-->
| tradename = 
| Drugs.com = {{drugs.com|CONS|cefoperazone}}
| MedlinePlus = a601206
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status = 
| routes_of_administration = 
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = Hati
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 62893-19-0
| ATC_prefix = J01
| ATC_suffix = DD12
| ATC_supplemental = {{ATCvet|J51|DD12}}
| PubChem = 44185
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01329
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 40206
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7U75I1278D
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07645
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 507674
<!--Chemical data-->
| C=25 | H=27 | N=9 | O=8 | S=2
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccc(O)cc3)NC(=O)N4C(=O)C(=O)N(CC)CC4)CSc5nnnn5C)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H27N9O8S2/c1-3-32-8-9-33(21(39)20(32)38)24(42)27-15(12-4-6-14(35)7-5-12)18(36)26-16-19(37)34-17(23(40)41)13(10-43-22(16)34)11-44-25-28-29-30-31(25)2/h4-7,15-16,22,35H,3,8-11H2,1-2H3,(H,26,36)(H,27,42)(H,40,41)/t15-,16-,22-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GCFBRXLSHGKWDP-XCGNWRKASA-N
}}

'''Sefoperazon''' adalah [[antibiotik]] [[sefalosporin]] generasi ketiga yang. Ini adalah salah satu dari sedikit antibiotik sefalosporin yang efektif dalam mengobati infeksi bakteri ''[[Pseudomonas]]'' yang resisten terhadap antibiotik golongan ini. 

Obat ini dipatenkan pada tahun 1974 dan disetujui untuk penggunaan medis pada tahun 1981.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=494 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA494 |language=en}}</ref> [[Sefoperazon/sulbaktam]] (Sulperazon) adalah formulasi bersama dengan [[sulbaktam]].

==Spektrum kerentanan bakteri==
Sefoperazon memiliki spektrum aktivitas yang luas dan telah digunakan untuk menargetkan bakteri yang menyebabkan infeksi pada saluran pernafasan dan saluran kemih, kulit, dan saluran kelamin wanita. Berikut ini merupakan data kerentanan MIC untuk beberapa mikroorganisme yang signifikan secara medis. 

*''[[Haemophilus influenzae]]'': 0,12 - 0,25 g/ml 
*''[[Staphylococcus aureus]]'': 0,125 - 32 g/ml 
*''[[Streptococcus pneumoniae]]'': ≤0,007 - 1 [[mikrogram|μg]]/ml<ref>{{cite web|url=http://antibiotics.toku-e.com/antimicrobial_462_1.html|title=Cefoperazone (Cefobid) - The Antimicrobial Index Knowledgebase - TOKU-E|website=antibiotics.toku-e.com}}</ref>

==Efek samping==
Sefoperazon mengandung [[rantai samping]] N-metiltiotetrazola (NMTT atau 1-MTT). Saat antibiotik 
ini dipecah di dalam tubuh, ia melepaskan NMTT bebas, yang dapat menyebabkan hipoprotrombinemia (kemungkinan karena penghambatan enzim vitamin K epoksida reduktase) dan reaksi dengan etanol serupa dengan yang dihasilkan oleh disulfiram (efek Antabuse), karena penghambatan aldehida dehidrogenase.<ref name=Goldfrank>{{cite book | vauthors = Stork CM |veditors=Nelson LH, Flomenbaum N, Goldfrank LR, Hoffman RL, Howland MD, Lewin NA |title=Goldfrank's toxicologic emergencies |chapter=Antibiotics, antifungals, and antivirals |chapter-url=https://books.google.com/books?id=cvJuLqBxGUcC&pg=PA847 |publisher=McGraw-Hill |location=New York |year=2006 |pages=847 |isbn=0-07-143763-0 |access-date=2009-07-03 }}</ref>

==Referensi==
{{Reflist}}
[[Kategori:Antibiotik sefalosporin]]
[[Kategori:Penghambat dehidrogenase asetaldehida]]
[[Kategori:Asetamida]]
[[Kategori:Senyawa 4-hidroksifenil]]
[[Kategori:Laktam]]
[[Kategori:Piperazina]]
[[Kategori:Tetrazola]]
[[Kategori:Obat yang dikembangkan oleh Pfizer]]
{{Farmasi-stub}}