Lompat ke isi

Asam laktat: Perbedaan antara revisi

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Konten dihapus Konten ditambahkan
ESCa (bicara | kontrib)
k +chembox, recat
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler
(37 revisi perantara oleh 22 pengguna tidak ditampilkan)
Baris 1: Baris 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Name = Lactic acid
| Watchedfields = changed
| ImageFileL1 = Lactic-acid-skeletal.svg
| verifiedrevid = 477002503
| ImageSizeL1 = 120px
| Name = Asam laktat
| ImageNameL1 = Skeletal formula of lactic acid
| ImageFile =
| ImageFileR1 = Lactic-acid-3D-balls.png
| ImageFileL1 = 7 Milchsäure.svg
| ImageSizeR1 = 120px
| ImageSizeL1 = 110
| ImageNameR1 = Ball-and-stick model of lactic acid
| ImageNameL1 = Skeletal formula of <small>L</small>-lactic acid
| IUPACName = 2-hydroxypropanoic acid
| ImageCaptionL1 =
''Note:'' The S enantiomer is depicted in each of the structural models included above.
| ImageFileR1 = File:L-Lactic acid molecule spacefill.png
| ImageSizeR1 = 130
| ImageNameR1 =
| ImageCaption2 = <small>rac</small>-Lactic acid
| PIN = 2-Hydroxypropanoic acid<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = [[Royal Society of Chemistry|The Royal Society of Chemistry]] | date = 2014 | location = Cambridge | page = 748 | doi = 10.1039/9781849733069-00648 | isbn = 978-0-85404-182-4}}</ref>
| SystematicName =
| OtherNames = Lactic acid<ref name=iupac2013 /><br />Milk acid
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 2932
| CASNo= 50-21-5
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br/><small>D</small>/<small>L</small>: [50-21-5] <br /><small>L</small>: [79-33-4]<br /><small>D</small>: [10326-41-7]
| CASNo = 50-21-5
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1 = 79-33-4
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 330546
| CASNo1_Comment = (<small>L</small>)
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 10326-41-7
| CASNo2_Comment = (<small>D</small>)
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 33X04XA5AT
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 422
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JVTAAEKCZFNVCJ-REOHCLBHSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 96860
| ChemSpiderID = 96860
| SMILES = CC(O)C(=O)O
| SMILES = CC(O)C(=O)O
}}
| Section2 = {{Chembox Properties
| C=3 | H=6 | O=3
| MeltingPt =53&nbsp;°C
| BoilingPtC = 122
| BoilingPt_notes = @ 15 mmHg
| pKa = 3.86,<ref>{{cite book| vauthors = Dawson RM |displayauthors=etal|title=Data for Biochemical Research|location=Oxford|publisher=Clarendon Press|date=1959}}</ref> 15.1<ref>{{cite journal | vauthors = Silva AM, Kong X, Hider RC | title = Determination of the pKa value of the hydroxyl group in the alpha-hydroxycarboxylates citrate, malate and lactate by 13C NMR: implications for metal coordination in biological systems | journal = Biometals | volume = 22 | issue = 5 | pages = 771–8 | date = October 2009 | pmid = 19288211 | doi = 10.1007/s10534-009-9224-5 }}</ref>
}}
| Section3 =
| Section4 = {{Chembox Thermochemistry| DeltaHc = 1361.9&nbsp;kJ/mol, 325.5&nbsp;kcal/mol, 15.1&nbsp;kJ/g, 3.61&nbsp;kcal/g}}
| Section8 = {{Chembox Related
| OtherAnions = lactate
| OtherFunction_label = [[carboxylic acid]]s
| OtherFunction = [[acetic acid]]<br />[[glycolic acid]]<br />[[propionic acid]]<br />[[3-hydroxypropanoic acid]]<br />[[malonic acid]]<br />[[butyric acid]]<br />[[hydroxybutyric acid]]
| OtherCompounds = [[1-propanol]]<br />[[2-propanol]]<br />[[propionaldehyde]]<br />[[acrolein]]<br />[[sodium lactate]]
}}
| Section5 =
| Section6 = {{Chembox Pharmacology
| ATCCode_prefix = G01
| ATCCode_prefix = G01
| ATCCode_suffix = AD01
| ATCCode_suffix = AD01
| ATC_Supplemental = {{ATCvet|P53|AG02}}
| ATC_Supplemental = {{ATCvet|P53|AG02}}
}}
| Section7 = {{Chembox Hazards
| GHSPictograms = {{GHSp|GHS05}}<ref name="sigma">{{Sigma-Aldrich|sial|id=69785|name=DL-Lactic acid|access-date=20 July 2013}}</ref>
| HPhrases = {{H-phrases|315|318}}<ref name="sigma" />
| PPhrases = {{P-phrases|280|305+351+338}}<ref name="sigma" />
}}
}}
| Section2 = {{Chembox Properties
| Section8 = {{Chembox Related
| OtherAnions = laktat
| Formula = C<sub>3</sub>H<sub>6</sub>O<sub>3</sub>
| Function = [[asam karboksilat]]
| MolarMass = 90.08 g/mol
| OtherFunctn = [[asam asetat]]<br />'''[[asam glikolat]]'''<br />''[[asam propionat]]''<br />''[[asam 3-hidroksipropanoat]]''<br />[[asam malonat]]<br />[[asam butirat]]<br />'''[[asam hidroksibutirat]]'''
| MeltingPt =<small>L</small>: 53 °C<br /><small>D</small>: 53 °C<br /><small>D</small>/<small>L</small>: 16.8 °C
| OtherCpds = [[1-propanol]]<br />[[2-propanol]]<br />[[propionaldehid]]<br />[[akrolein]]<br />[[natrium laktat]]
| BoilingPt = 122 °C @ 12 mmHg
| pKa = 3.86 at 25&nbsp;°C
}}
| Section4 = {{Chembox Related
| OtherAnions = lactate
| Function = [[carboxylic acid]]s
| OtherFunctn = [[acetic acid]]<br />'''[[glycolic acid]]'''<br />''[[propionic acid]]''<br />''[[3-hydroxypropanoic acid]]''<br />[[malonic acid]]<br />[[butyric acid]]<br />'''[[hydroxybutyric acid]]'''
| OtherCpds = [[1-propanol]]<br />[[2-propanol]]<br />[[propionaldehyde]]<br />[[acrolein]]<br />[[sodium lactate]]
}}
}}
}}
}}


'''Asam laktat''' (Nama [[IUPAC]]: '''asam 2-hidroksipropanoat''' (CH3-CHOH-COOH), dikenal juga sebagai '''asam susu''') adalah [[senyawa kimia]] penting dalam beberapa proses [[biokimia]]. Seorang ahli kimia [[Swedia]], [[Carl Wilhelm Scheele]], pertama kali meng[[isolasi]]nya pada tahun [[1780]]. Secara struktur, ia adalah [[asam karboksilat]] dengan satu [[gugus]] [hidroksil] yang menempel pada gugus [[karboksil]]. Dalam [[air]], ia terlarut lemah dan melepas [[proton]] (H<sup>+</sup>), membentuk [[ion]] laktat. Asam ini juga larut dalam [[alkohol]] dan bersifat menyerap air (higroskopik).
'''Asam lakta''' atau '''asam susu''' (CH3-CHOH-COOH) adalah [[senyawa kimia]] penting dalam beberapa proses [[biokimia]]. Seorang ahli kimia [[Swedia]], [[Carl Wilhelm Scheele]], kali meng[[isolasi]]nya pada tahun [[1780]]. Secara struktur, ia adalah [[asam karboksilat]] dengan satu [[gugus hidroksil]] yang menempel pada gugus [[karboksil]]. Dalam [[air]], ia terlarut dengan melepas [[proton]] (H<sup>+</sup>), membentuk [[ion]] laktat. Asam ini juga larut dalam [[alkohol]] dan bersifat menyerap air (higroskopik).


Asam ini memiliki simetri cermin ([[kiralitas]]), dengan dua [[isomer]]: asam <small>L</small>-(+)-laktat atau asam (''S'')-laktat dan, cerminannya, iasam <small>D</small>-(-)-laktat atau asam (''R'')-laktat. Hanya isomer yang pertama (S) aktif secara [[biologi]].
Asam ini memiliki simetri cermin ([[kiralitas]]), dengan dua [[isomer]]: asam <small>L</small>-(+)-laktat atau asam (''S'')-laktat dan, cerminannya, iasam <small>D</small>-(-)-laktat atau asam (''R'')-laktat. Hanya isomer yang pertama (S) aktif secara [[biologi]]


== Pranala luar ==
[[Kategori:Asam organik]]
* [http://www.smithsonianmag.com/science-nature/10022381.html Corn Plastic to the Rescue] {{Webarchive|url=https://web.archive.org/web/20131121122758/http://www.smithsonianmag.com/science-nature/10022381.html |date=2013-11-21 }}
* [http://www.webmd.com/a-to-z-guides/lactic-acid Lactic Acid: Information and Resources]
* [https://www.nytimes.com/2006/05/16/health/nutrition/16run.html Lactic Acid Is Not Muscles' Foe, It's Fuel]
* {{cite web |first=Matt |last=Fitzgerald |name-list-format=vanc |date=January 26, 2010 |title=The Lactic Acid Myths |work=Competitor Running |url=http://running.competitor.com/2010/01/training/the-lactic-acid-myths_7938 |access-date=2018-09-10 |archive-date=2018-09-24 |archive-url=https://web.archive.org/web/20180924110049/https://running.competitor.com/2010/01/training/the-lactic-acid-myths_7938 |dead-url=yes }}


{{Portal|Kimia}}
[[ar:حمض لاكتيك]]
{{Authority control}}
[[bg:Млечна киселина]]

[[ca:Àcid làctic]]
[[Kategori:Asam organik]]
[[cs:Kyselina mléčná]]
[[cy:Asid lactig]]
[[da:Mælkesyre]]
[[de:Milchsäure]]
[[el:Γαλακτικό οξύ]]
[[en:Lactic acid]]
[[eo:Lakta acido]]
[[es:Ácido láctico]]
[[et:Piimhape]]
[[eu:Azido laktiko]]
[[fa:اسید لاکتیک]]
[[fi:Maitohappo]]
[[fr:Acide lactique]]
[[he:חומצה לקטית]]
[[hu:Tejsav]]
[[is:Mjólkursýra]]
[[it:Acido lattico]]
[[ja:乳酸]]
[[ko:젖산]]
[[lb:Mëllechsaier]]
[[lt:Pieno rūgštis]]
[[lv:Pienskābe]]
[[nl:Melkzuur]]
[[nn:Mjølkesyre]]
[[no:Melkesyre]]
[[pl:Kwas mlekowy]]
[[pt:Ácido láctico]]
[[ro:Acid lactic]]
[[ru:Молочная кислота]]
[[sh:Mliječna kiselina]]
[[simple:Lactic acid]]
[[sk:Kyselina mliečna]]
[[sl:Mlečna kislina]]
[[sq:Acidi Laktik]]
[[sr:Млијечна киселина]]
[[su:Asam laktat]]
[[sv:Mjölksyra]]
[[tr:Laktik asit]]
[[uk:Молочна кислота]]
[[zh:乳酸]]

Revisi per 15 April 2024 23.25

Asam laktat
Skeletal formula of L-lactic acid
Skeletal formula of L-lactic acid
Nama
Nama IUPAC (preferensi)
2-Hydroxypropanoic acid[1]
Nama lain
Lactic acid[1]
Milk acid
Penanda
Model 3D (JSmol)
3DMet {{{3DMet}}}
ChEBI
ChEMBL
ChemSpider
Nomor EC
Nomor RTECS {{{value}}}
UNII
  • InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 YaY
    Key: JVTAAEKCZFNVCJ-REOHCLBHSA-N YaY
  • CC(O)C(=O)O
Sifat
C3H6O3
Massa molar 90,08 g·mol−1
Titik lebur 53 °C
Titik didih 122 °C (252 °F; 395 K) @ 15 mmHg
Keasaman (pKa) 3.86,[2] 15.1[3]
Termokimia
Entalpi
pembakaran
standar
ΔcHo298
1361.9 kJ/mol, 325.5 kcal/mol, 15.1 kJ/g, 3.61 kcal/g
Farmakologi
Kode ATC G01AD01
QP53AG02
Bahaya
Piktogram GHS [4]
H315, H318[4]
P280, P305+351+338[4]
Senyawa terkait
Anion lain
laktat
Kecuali dinyatakan lain, data di atas berlaku pada suhu dan tekanan standar (25 °C [77 °F], 100 kPa).
N verifikasi (apa ini YaYN ?)
Referensi

Asam lakta atau asam susu (CH3-CHOH-COOH) adalah senyawa kimia penting dalam beberapa proses biokimia. Seorang ahli kimia Swedia, Carl Wilhelm Scheele, kali mengisolasinya pada tahun 1780. Secara struktur, ia adalah asam karboksilat dengan satu gugus hidroksil yang menempel pada gugus karboksil. Dalam air, ia terlarut dengan melepas proton (H+), membentuk ion laktat. Asam ini juga larut dalam alkohol dan bersifat menyerap air (higroskopik).

Asam ini memiliki simetri cermin (kiralitas), dengan dua isomer: asam L-(+)-laktat atau asam (S)-laktat dan, cerminannya, iasam D-(-)-laktat atau asam (R)-laktat. Hanya isomer yang pertama (S) aktif secara biologi

Pranala luar

  1. ^ a b Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book). Cambridge: The Royal Society of Chemistry. 2014. hlm. 748. doi:10.1039/9781849733069-00648. ISBN 978-0-85404-182-4. 
  2. ^ Dawson RM, et al. (1959). Data for Biochemical Research. Oxford: Clarendon Press. 
  3. ^ Silva AM, Kong X, Hider RC (October 2009). "Determination of the pKa value of the hydroxyl group in the alpha-hydroxycarboxylates citrate, malate and lactate by 13C NMR: implications for metal coordination in biological systems". Biometals. 22 (5): 771–8. doi:10.1007/s10534-009-9224-5. PMID 19288211. 
  4. ^ a b c Sigma-Aldrich Co., DL-Lactic acid.