Lompat ke isi

Asam laktat: Perbedaan antara revisi

Dari Wikipedia bahasa Indonesia, ensiklopedia bebas
Konten dihapus Konten ditambahkan
Tidak ada ringkasan suntingan
Tag: Suntingan perangkat seluler Suntingan peramban seluler
 
(15 revisi perantara oleh 10 pengguna tidak ditampilkan)
Baris 1: Baris 1:
{{chembox
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477002503
| Name = Asam laktat
| Name = Asam laktat
| ImageFile =
| ImageFileL1 = Lactic-acid-skeletal.svg
| ImageFileL1 = 7 Milchsäure.svg
| ImageSizeL1 = 120px
| ImageSizeL1 = 110
| ImageNameL1 = Skeletal formula of lactic acid
| ImageNameL1 = Skeletal formula of <small>L</small>-lactic acid
| ImageFileR1 = Lactic-acid-3D-balls.png
| ImageSizeR1 = 120px
| ImageCaptionL1 =
| ImageFileR1 = File:L-Lactic acid molecule spacefill.png
| ImageNameR1 = Ball-and-stick model of lactic acid
| ImageSizeR1 = 130
| IUPACName = 2-hydroxypropanoic acid
| ImageNameR1 =
''Note:'' The S enantiomer is depicted in each of the structural models included above.
| ImageCaption2 = <small>rac</small>-Lactic acid
| PIN = 2-Hydroxypropanoic acid<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = [[Royal Society of Chemistry|The Royal Society of Chemistry]] | date = 2014 | location = Cambridge | page = 748 | doi = 10.1039/9781849733069-00648 | isbn = 978-0-85404-182-4}}</ref>
| SystematicName =
| OtherNames = Lactic acid<ref name=iupac2013 /><br />Milk acid
| Section1 = {{Chembox Identifiers
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 2932
| CASNo= 50-21-5
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br /><small>D</small>/<small>L</small>: [50-21-5] <br /><small>L</small>: [79-33-4]<br /><small>D</small>: [10326-41-7]
| CASNo = 50-21-5
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo1 = 79-33-4
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 330546
| CASNo1_Comment = (<small>L</small>)
| CASNo2_Ref = {{cascite|correct|CAS}}
| CASNo2 = 10326-41-7
| CASNo2_Comment = (<small>D</small>)
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 33X04XA5AT
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 422
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JVTAAEKCZFNVCJ-REOHCLBHSA-N
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 96860
| ChemSpiderID = 96860
| SMILES = CC(O)C(=O)O
| SMILES = CC(O)C(=O)O
}}
| Section2 = {{Chembox Properties
| C=3 | H=6 | O=3
| MeltingPt =53&nbsp;°C
| BoilingPtC = 122
| BoilingPt_notes = @ 15 mmHg
| pKa = 3.86,<ref>{{cite book| vauthors = Dawson RM |displayauthors=etal|title=Data for Biochemical Research|location=Oxford|publisher=Clarendon Press|date=1959}}</ref> 15.1<ref>{{cite journal | vauthors = Silva AM, Kong X, Hider RC | title = Determination of the pKa value of the hydroxyl group in the alpha-hydroxycarboxylates citrate, malate and lactate by 13C NMR: implications for metal coordination in biological systems | journal = Biometals | volume = 22 | issue = 5 | pages = 771–8 | date = October 2009 | pmid = 19288211 | doi = 10.1007/s10534-009-9224-5 }}</ref>
}}
| Section3 =
| Section4 = {{Chembox Thermochemistry| DeltaHc = 1361.9&nbsp;kJ/mol, 325.5&nbsp;kcal/mol, 15.1&nbsp;kJ/g, 3.61&nbsp;kcal/g}}
| Section8 = {{Chembox Related
| OtherAnions = lactate
| OtherFunction_label = [[carboxylic acid]]s
| OtherFunction = [[acetic acid]]<br />[[glycolic acid]]<br />[[propionic acid]]<br />[[3-hydroxypropanoic acid]]<br />[[malonic acid]]<br />[[butyric acid]]<br />[[hydroxybutyric acid]]
| OtherCompounds = [[1-propanol]]<br />[[2-propanol]]<br />[[propionaldehyde]]<br />[[acrolein]]<br />[[sodium lactate]]
}}
| Section5 =
| Section6 = {{Chembox Pharmacology
| ATCCode_prefix = G01
| ATCCode_prefix = G01
| ATCCode_suffix = AD01
| ATCCode_suffix = AD01
| ATC_Supplemental = {{ATCvet|P53|AG02}}
| ATC_Supplemental = {{ATCvet|P53|AG02}}
}}
| Section7 = {{Chembox Hazards
| GHSPictograms = {{GHSp|GHS05}}<ref name="sigma">{{Sigma-Aldrich|sial|id=69785|name=DL-Lactic acid|access-date=20 July 2013}}</ref>
| HPhrases = {{H-phrases|315|318}}<ref name="sigma" />
| PPhrases = {{P-phrases|280|305+351+338}}<ref name="sigma" />
}}
}}
| Section2 = {{Chembox Properties
| Section8 = {{Chembox Related
| Formula = C<sub>3</sub>H<sub>6</sub>O<sub>3</sub>
| MolarMass = 90.08 g/mol
| MeltingPt =<small>L</small>: 53&nbsp;°C<br /><small>D</small>: 53&nbsp;°C<br /><small>D</small>/<small>L</small>: 16.8&nbsp;°C
| BoilingPt = 122&nbsp;°C @ 12 mmHg
| pKa = 3.86 at 25&nbsp;°C
}}
| Section4 = {{Chembox Related
| OtherAnions = laktat
| OtherAnions = laktat
| Function = [[asam karboksilat]]
| Function = [[asam karboksilat]]
Baris 33: Baris 74:
}}
}}


'''Asam laktat''' (Nama [[IUPAC]]: '''asam 2-hidroksipropanoat''' (CH3-CHOH-COOH), dikenal juga sebagai '''asam susu''') adalah [[senyawa kimia]] penting dalam beberapa proses [[biokimia]]. Seorang ahli kimia [[Swedia]], [[Carl Wilhelm Scheele]], pertama kali meng[[isolasi]]nya pada tahun [[1780]]. Secara struktur, ia adalah [[asam karboksilat]] dengan satu [[gugus hidroksil]] yang menempel pada gugus [[karboksil]]. Dalam [[air]], ia terlarut lemah dan melepas [[proton]] (H<sup>+</sup>), membentuk [[ion]] laktat. Asam ini juga larut dalam [[alkohol]] dan bersifat menyerap air (higroskopik).
'''Asam laktat''' atau '''asam susu''' (CH3-CHOH-COOH) adalah [[senyawa kimia]] penting dalam beberapa proses [[biokimia]]. Seorang ahli kimia [[Swedia]], [[Carl Wilhelm Scheele]], pertama kali meng[[isolasi]]nya pada tahun [[1780]]. Secara struktur, ia adalah [[asam karboksilat]] dengan satu [[gugus hidroksil]] yang menempel pada gugus [[karboksil]]. Dalam [[air]], ia terlarut dengan melepas [[proton]] (H<sup>+</sup>), membentuk [[ion]] laktat. Asam ini juga larut dalam [[alkohol]] dan bersifat menyerap air (higroskopik).

Asam ini memiliki simetri cermin ([[kiralitas]]), dengan dua [[isomer]]: asam <small>L</small>-(+)-laktat atau asam (''S'')-laktat dan, cerminannya, iasam <small>D</small>-(-)-laktat atau asam (''R'')-laktat. Hanya isomer yang pertama (S) aktif secara [[biologi]]

== Pranala luar ==
* [http://www.smithsonianmag.com/science-nature/10022381.html Corn Plastic to the Rescue] {{Webarchive|url=https://web.archive.org/web/20131121122758/http://www.smithsonianmag.com/science-nature/10022381.html |date=2013-11-21 }}
* [http://www.webmd.com/a-to-z-guides/lactic-acid Lactic Acid: Information and Resources]
* [https://www.nytimes.com/2006/05/16/health/nutrition/16run.html Lactic Acid Is Not Muscles' Foe, It's Fuel]
* {{cite web |first=Matt |last=Fitzgerald |name-list-format=vanc |date=January 26, 2010 |title=The Lactic Acid Myths |work=Competitor Running |url=http://running.competitor.com/2010/01/training/the-lactic-acid-myths_7938 |access-date=2018-09-10 |archive-date=2018-09-24 |archive-url=https://web.archive.org/web/20180924110049/https://running.competitor.com/2010/01/training/the-lactic-acid-myths_7938 |dead-url=yes }}


Asam ini memiliki simetri cermin ([[kiralitas]]), dengan dua [[isomer]]: asam <small>L</small>-(+)-laktat atau asam (''S'')-laktat dan, cerminannya, iasam <small>D</small>-(-)-laktat atau asam (''R'')-laktat. Hanya isomer yang pertama (S) aktif secara [[biologi]].
{{Portal|Kimia}}
{{Portal|Kimia}}
{{Authority control}}


[[Kategori:Asam organik]]
[[Kategori:Asam organik|laktat]]
[[Kategori:asam hidroksikarboksilat alfa|laktat]]
[[Kategori:Pengatur keasaman]]
[[Kategori:Pengawet]]
[[Kategori:Bahan tambahan pangan bernomor Uni Eropa]]

Revisi terkini sejak 22 Oktober 2024 15.50

Asam laktat
Skeletal formula of L-lactic acid
Skeletal formula of L-lactic acid
Nama
Nama IUPAC (preferensi)
2-Hydroxypropanoic acid[1]
Nama lain
Lactic acid[1]
Milk acid
Penanda
Model 3D (JSmol)
3DMet {{{3DMet}}}
ChEBI
ChEMBL
ChemSpider
Nomor EC
Nomor RTECS {{{value}}}
UNII
  • InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 YaY
    Key: JVTAAEKCZFNVCJ-REOHCLBHSA-N YaY
  • CC(O)C(=O)O
Sifat
C3H6O3
Massa molar 90,08 g·mol−1
Titik lebur 53 °C
Titik didih 122 °C (252 °F; 395 K) @ 15 mmHg
Keasaman (pKa) 3.86,[2] 15.1[3]
Termokimia
Entalpi
pembakaran
standar
ΔcHo298
1361.9 kJ/mol, 325.5 kcal/mol, 15.1 kJ/g, 3.61 kcal/g
Farmakologi
Kode ATC G01AD01
QP53AG02
Bahaya
Piktogram GHS [4]
H315, H318[4]
P280, P305+351+338[4]
Senyawa terkait
Anion lain
laktat
Kecuali dinyatakan lain, data di atas berlaku pada suhu dan tekanan standar (25 °C [77 °F], 100 kPa).
N verifikasi (apa ini YaYN ?)
Referensi

Asam laktat atau asam susu (CH3-CHOH-COOH) adalah senyawa kimia penting dalam beberapa proses biokimia. Seorang ahli kimia Swedia, Carl Wilhelm Scheele, pertama kali mengisolasinya pada tahun 1780. Secara struktur, ia adalah asam karboksilat dengan satu gugus hidroksil yang menempel pada gugus karboksil. Dalam air, ia terlarut dengan melepas proton (H+), membentuk ion laktat. Asam ini juga larut dalam alkohol dan bersifat menyerap air (higroskopik).

Asam ini memiliki simetri cermin (kiralitas), dengan dua isomer: asam L-(+)-laktat atau asam (S)-laktat dan, cerminannya, iasam D-(-)-laktat atau asam (R)-laktat. Hanya isomer yang pertama (S) aktif secara biologi

Pranala luar

[sunting | sunting sumber]
  1. ^ a b Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book). Cambridge: The Royal Society of Chemistry. 2014. hlm. 748. doi:10.1039/9781849733069-00648. ISBN 978-0-85404-182-4. 
  2. ^ Dawson RM, et al. (1959). Data for Biochemical Research. Oxford: Clarendon Press. 
  3. ^ Silva AM, Kong X, Hider RC (October 2009). "Determination of the pKa value of the hydroxyl group in the alpha-hydroxycarboxylates citrate, malate and lactate by 13C NMR: implications for metal coordination in biological systems". Biometals. 22 (5): 771–8. doi:10.1007/s10534-009-9224-5. PMID 19288211. 
  4. ^ a b c Sigma-Aldrich Co., DL-Lactic acid.