Asam fluoroantimonat: Perbedaan antara revisi
Konten dihapus Konten ditambahkan
k Bot: Penggantian teks otomatis (- + ) |
k PNG -> SVG |
||
| Baris 1: | Baris 1: | ||
{{Chembox|ImageFile=H2FSbF6. |
{{Chembox|ImageFile=H2FSbF6.svg|ImageFile2=Fluoroantimonic_acid-3D-balls.png|ImageSize=240px|IUPACName=Fluoroantimonic acid|SystematicName=Fluoranium hexafluorostibanuide<br>Fluoranium hexafluoridoantimonate(1−)|Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|changed|??}} | CASNo = 16950-06-4 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 32741664 | EINECS = 241-023-8 | SMILES = [FH2+].F[Sb-](F)(F)(F)(F)F | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/FH2.6FH.Sb/h1H2;6*1H;/q+1;;;;;;;+5/p-6 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = HBGBSIVYTBPVEU-UHFFFAOYSA-H }}|Section2={{Chembox Properties | Formula = {{Chem|H|2|SbF|7}} | MolarMass = 256.765 | Appearance = Cairan tak berwarna | Density = 2.885 g/cm<sup>3</sup> | pKa = −25 | pKb = 39 | Solvent = | SolubleOther = [[sulfuryl chloride fluoride|SO<sub>2</sub>ClF]], [[sulfur dioxide|SO<sub>2</sub>]] }}|Section3={{Chembox Hazards | MainHazards = Sangat korosif , Hidrolisis kuat | HPhrases = {{H-phrases|300|310|314|330|411}} | PPhrases = {{P-phrases|260|264|273|280|284|301+310}} | RPhrases = {{R26}}, {{R29}}, {{R35}} | SPhrases = {{S1/2}}, {{S36/37/39}}, {{S45}}, {{S53}}, {{S60}}, {{S61}} | NFPA-H = 4 | NFPA-F = 0 | NFPA-R = 3 | NFPA-S = W }}|Section4={{Chembox Related | OtherFunction_label = [[acid]]s | OtherFunction = [[Antimony pentafluoride]]<br /> [[Hydrogen fluoride]]<br /> [[Magic acid]] }}}}'''Asam''' '''Fluoroantimonat''' adalah [[senyawa anorganik]] dengan [[rumus kimia]] {{Chem|H|2|FSbF|6}} (dapat ditulis {{Chem|H|2|F[SbF|6|]}}, 2HF·SbF<sub>5</sub>, atau HF-SbF<sub>5</sub>). Ini adalah aplikasi larutan ion yang dibuat dengan reaksi [[Asam fluorida|hidrogen fluorida]] (HF) dengan [[antimon pentafluorida]] (SbF<sub>5</sub>) dalam rasio [[stoikiometri]] 2:1. ini adalah yang asam terkuat terkuat yang dikenal [[superasam]].<ref>{{Cite book|title=A Life of Magic Chemistry: Autobiographical Reflections of a Nobel Prize Winner|last=Olah|first=G. A.|date=2001|publisher=[[John Wiley and Sons]]|isbn=0-471-15743-0|pages=100–101|author-link=George Olah}}</ref> Asam yang sama dapat dibuat dengan menggunakan kelebihan antimon pentafluorida.<ref name="Olah">{{cite encyclopedia|authorlink1=George Olah|last1=Olah|first1=G. A.|last2=Prakash|first2=G. K. Surya|last3=Wang|first3=Qi|last4=Li|first4=Xing-ya|title=Hydrogen Fluoride–Antimony(V) Fluoride|encyclopedia=[[Encyclopedia of Reagents for Organic Synthesis]]|date=15 April 2001|publisher=[[John Wiley and Sons]]|location=New York|doi=10.1002/047084289X.rh037m|url=http://onlinelibrary.wiley.com/o/eros/articles/rh037m/frame.html|isbn=9780470842898}}</ref> |
||
Reaksi untuk menghasilkan asam fluoroantimonat adalah: |
Reaksi untuk menghasilkan asam fluoroantimonat adalah: |
||
Revisi per 30 Juli 2020 05.33
| |
| |
| Nama | |
|---|---|
| Nama IUPAC
Fluoroantimonic acid
| |
| Nama IUPAC (sistematis)
Fluoranium hexafluorostibanuide Fluoranium hexafluoridoantimonate(1−) | |
| Penanda | |
Model 3D (JSmol)
|
|
| 3DMet | {{{3DMet}}} |
| ChemSpider | |
| Nomor EC | |
| Nomor RTECS | {{{value}}} |
CompTox Dashboard (EPA)
|
|
| |
| |
| Sifat | |
| H2SbF7 | |
| Massa molar | 256.765 |
| Penampilan | Cairan tak berwarna |
| Densitas | 2.885 g/cm3 |
| Kelarutan | SO2ClF, SO2 |
| Keasaman (pKa) | −25 |
| Kebasaan (pKb) | 39 |
| Bahaya | |
| Bahaya utama | Sangat korosif , Hidrolisis kuat |
| H300, H310, H314, H330, H411 | |
| P260, P264, P273, P280, P284, P301+310 | |
| Senyawa terkait | |
Related acids
|
Antimony pentafluoride Hydrogen fluoride Magic acid |
Kecuali dinyatakan lain, data di atas berlaku pada suhu dan tekanan standar (25 °C [77 °F], 100 kPa). | |
| Referensi | |
Asam Fluoroantimonat adalah senyawa anorganik dengan rumus kimia H2FSbF6 (dapat ditulis H2F[SbF6], 2HF·SbF5, atau HF-SbF5). Ini adalah aplikasi larutan ion yang dibuat dengan reaksi hidrogen fluorida (HF) dengan antimon pentafluorida (SbF5) dalam rasio stoikiometri 2:1. ini adalah yang asam terkuat terkuat yang dikenal superasam.[1] Asam yang sama dapat dibuat dengan menggunakan kelebihan antimon pentafluorida.[2]
Reaksi untuk menghasilkan asam fluoroantimonat adalah:
- 2 HF ⇌ H2F+ + F−
- SbF5 + F− → SbF−6
Reaksi keseluruhan adalah:
- SbF5 + 2 HF → SbF−6 + H2F+
Reaksi kedua adalah tidak setimbang, oleh karena itu reaksi ini bersifat eksotermik.
Aplikasi
Asam yang luar biasa ini memprotonasi hampir semua senyawa organik. Pada tahun 1967, Bickel dan Hogeveen menunjukkan bahwa 2HF·SbF5 akan mengambil H2 dari isobutana dan metana dari neopentane untuk membentuk ion karbokation:[3][4]
- (CH3)3CH + H+ → (CH3)3C+ + H2
- (CH3)4C + H+ → (CH3)3C+ + CH4
Bahan-bahan yang sesuai dengan asam fluoroantimonat sebagai pelarut meliputi SO2ClF, dan sulfur dioksida; beberapa klorofluorokarbon juga telah digunakan. Wadah untuk penyimpanan HF-SbF5 terbuat dari PTFE.
Keamanan
HF-SbF5 ini sangat korosif, beracun, dan sensitif terhadap kelembaban.[2] Seperti kebanyakan asam kuat, asam fluoroantimonat bereaksi hebat dengan air, menyebabkan hidrasi eksotermik. Akibatnya, hal ini tidak dapat digunakan dalam larutan air, hanya dalam larutan asam fluorida .
Lihat juga
Referensi
- ^ Olah, G. A. (2001). A Life of Magic Chemistry: Autobiographical Reflections of a Nobel Prize Winner. John Wiley and Sons. hlm. 100–101. ISBN 0-471-15743-0.
- ^ a b Olah, G. A.; Prakash, G. K. Surya; Wang, Qi; Li, Xing-ya (15 April 2001). "Hydrogen Fluoride–Antimony(V) Fluoride". Encyclopedia of Reagents for Organic Synthesis. New York: John Wiley and Sons. doi:10.1002/047084289X.rh037m. ISBN 9780470842898.
- ^ Bickel, A. F.; Gaasbeek, C. J.; Hogeveen, H.; Oelderik, J. M.; Platteeuw, J. C. (1967). "Chemistry and spectroscopy in strongly acidic solutions: reversible reaction between aliphatic carbonium ions and hydrogen". Chemical Communications. 1967 (13): 634–635. doi:10.1039/C19670000634.
- ^ Hogeveen, H.; Bickel, A. F. (1967). "Chemistry and spectroscopy in strongly acidic solutions: electrophilic substitution at alkane-carbon by protons". Chemical Communications. 1967 (13): 635–636. doi:10.1039/C19670000635.